4-methoxy-N-(4-methoxy-2-phenylquinolin-6-yl)benzamide
Chemical Structure Depiction of
4-methoxy-N-(4-methoxy-2-phenylquinolin-6-yl)benzamide
4-methoxy-N-(4-methoxy-2-phenylquinolin-6-yl)benzamide
Compound characteristics
| Compound ID: | L482-0138 |
| Compound Name: | 4-methoxy-N-(4-methoxy-2-phenylquinolin-6-yl)benzamide |
| Molecular Weight: | 384.43 |
| Molecular Formula: | C24 H20 N2 O3 |
| Smiles: | COc1ccc(cc1)C(Nc1ccc2c(c1)c(cc(c1ccccc1)n2)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 5.3875 |
| logD: | 5.3865 |
| logSw: | -5.6661 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.563 |
| InChI Key: | LZMJLFFSRZJJGR-UHFFFAOYSA-N |