N-(4-ethoxy-2-phenylquinolin-6-yl)-2-methylpropanamide
Chemical Structure Depiction of
N-(4-ethoxy-2-phenylquinolin-6-yl)-2-methylpropanamide
N-(4-ethoxy-2-phenylquinolin-6-yl)-2-methylpropanamide
Compound characteristics
| Compound ID: | L482-0163 |
| Compound Name: | N-(4-ethoxy-2-phenylquinolin-6-yl)-2-methylpropanamide |
| Molecular Weight: | 334.42 |
| Molecular Formula: | C21 H22 N2 O2 |
| Smiles: | CCOc1cc(c2ccccc2)nc2ccc(cc12)NC(C(C)C)=O |
| Stereo: | ACHIRAL |
| logP: | 5.1066 |
| logD: | 5.106 |
| logSw: | -5.0283 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 38.871 |
| InChI Key: | KBULIPXORLTUBK-UHFFFAOYSA-N |