N-(4-ethoxy-2-phenylquinolin-6-yl)-3,5-dimethoxybenzamide
Chemical Structure Depiction of
N-(4-ethoxy-2-phenylquinolin-6-yl)-3,5-dimethoxybenzamide
N-(4-ethoxy-2-phenylquinolin-6-yl)-3,5-dimethoxybenzamide
Compound characteristics
| Compound ID: | L482-0185 |
| Compound Name: | N-(4-ethoxy-2-phenylquinolin-6-yl)-3,5-dimethoxybenzamide |
| Molecular Weight: | 428.49 |
| Molecular Formula: | C26 H24 N2 O4 |
| Smiles: | CCOc1cc(c2ccccc2)nc2ccc(cc12)NC(c1cc(cc(c1)OC)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 6.0318 |
| logD: | 6.0312 |
| logSw: | -5.5673 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 53.687 |
| InChI Key: | GEHXHXWDWQJLDW-UHFFFAOYSA-N |