ethyl ({6-[2-(4-fluorophenoxy)acetamido]-2-phenylquinolin-4-yl}oxy)acetate
Chemical Structure Depiction of
ethyl ({6-[2-(4-fluorophenoxy)acetamido]-2-phenylquinolin-4-yl}oxy)acetate
ethyl ({6-[2-(4-fluorophenoxy)acetamido]-2-phenylquinolin-4-yl}oxy)acetate
Compound characteristics
| Compound ID: | L482-1877 |
| Compound Name: | ethyl ({6-[2-(4-fluorophenoxy)acetamido]-2-phenylquinolin-4-yl}oxy)acetate |
| Molecular Weight: | 474.49 |
| Molecular Formula: | C27 H23 F N2 O5 |
| Smiles: | CCOC(COc1cc(c2ccccc2)nc2ccc(cc12)NC(COc1ccc(cc1)F)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.3258 |
| logD: | 5.3257 |
| logSw: | -5.4258 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 66.419 |
| InChI Key: | YOBVNVWHGMCVBU-UHFFFAOYSA-N |