2-[(2-chlorophenyl)methyl]-8-methyl-1,3,4,5-tetrahydrobenzo[b][1,6]naphthyridin-10(2H)-one
Chemical Structure Depiction of
2-[(2-chlorophenyl)methyl]-8-methyl-1,3,4,5-tetrahydrobenzo[b][1,6]naphthyridin-10(2H)-one
2-[(2-chlorophenyl)methyl]-8-methyl-1,3,4,5-tetrahydrobenzo[b][1,6]naphthyridin-10(2H)-one
Compound characteristics
| Compound ID: | L488-1370 |
| Compound Name: | 2-[(2-chlorophenyl)methyl]-8-methyl-1,3,4,5-tetrahydrobenzo[b][1,6]naphthyridin-10(2H)-one |
| Molecular Weight: | 338.84 |
| Molecular Formula: | C20 H19 Cl N2 O |
| Smiles: | Cc1ccc2c(c1)C(C1CN(CCC=1N2)Cc1ccccc1[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 4.4639 |
| logD: | 4.4346 |
| logSw: | -4.4502 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 27.9137 |
| InChI Key: | IGCUOYINSJVAPA-UHFFFAOYSA-N |