N-[5-(azepane-1-sulfonyl)-2-methylthiophen-3-yl]-2-(naphthalen-1-yl)acetamide
Chemical Structure Depiction of
N-[5-(azepane-1-sulfonyl)-2-methylthiophen-3-yl]-2-(naphthalen-1-yl)acetamide
N-[5-(azepane-1-sulfonyl)-2-methylthiophen-3-yl]-2-(naphthalen-1-yl)acetamide
Compound characteristics
| Compound ID: | L497-3055 |
| Compound Name: | N-[5-(azepane-1-sulfonyl)-2-methylthiophen-3-yl]-2-(naphthalen-1-yl)acetamide |
| Molecular Weight: | 442.6 |
| Molecular Formula: | C23 H26 N2 O3 S2 |
| Smiles: | Cc1c(cc(s1)S(N1CCCCCC1)(=O)=O)NC(Cc1cccc2ccccc12)=O |
| Stereo: | ACHIRAL |
| logP: | 4.7995 |
| logD: | 4.7978 |
| logSw: | -5.4029 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.207 |
| InChI Key: | KTASEBOOHZOLAS-UHFFFAOYSA-N |