2-[2-(5-cyclobutyl-1,3,4-oxadiazol-2-yl)-1H-pyrrol-1-yl]-1-(2,3-dihydro-1H-indol-1-yl)ethan-1-one
Chemical Structure Depiction of
2-[2-(5-cyclobutyl-1,3,4-oxadiazol-2-yl)-1H-pyrrol-1-yl]-1-(2,3-dihydro-1H-indol-1-yl)ethan-1-one
2-[2-(5-cyclobutyl-1,3,4-oxadiazol-2-yl)-1H-pyrrol-1-yl]-1-(2,3-dihydro-1H-indol-1-yl)ethan-1-one
Compound characteristics
| Compound ID: | L505-2414 |
| Compound Name: | 2-[2-(5-cyclobutyl-1,3,4-oxadiazol-2-yl)-1H-pyrrol-1-yl]-1-(2,3-dihydro-1H-indol-1-yl)ethan-1-one |
| Molecular Weight: | 348.4 |
| Molecular Formula: | C20 H20 N4 O2 |
| Smiles: | C1CC(C1)c1nnc(c2cccn2CC(N2CCc3ccccc23)=O)o1 |
| Stereo: | ACHIRAL |
| logP: | 2.7721 |
| logD: | 2.7721 |
| logSw: | -2.9014 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 48.018 |
| InChI Key: | OXLOMZDLDJSBRY-UHFFFAOYSA-N |