N~1~-(3-methoxyphenyl)-N~4~-[(2-phenyl-1,3-thiazol-4-yl)methyl]piperidine-1,4-dicarboxamide
Chemical Structure Depiction of
N~1~-(3-methoxyphenyl)-N~4~-[(2-phenyl-1,3-thiazol-4-yl)methyl]piperidine-1,4-dicarboxamide
N~1~-(3-methoxyphenyl)-N~4~-[(2-phenyl-1,3-thiazol-4-yl)methyl]piperidine-1,4-dicarboxamide
Compound characteristics
| Compound ID: | L517-0198 |
| Compound Name: | N~1~-(3-methoxyphenyl)-N~4~-[(2-phenyl-1,3-thiazol-4-yl)methyl]piperidine-1,4-dicarboxamide |
| Molecular Weight: | 450.56 |
| Molecular Formula: | C24 H26 N4 O3 S |
| Smiles: | COc1cccc(c1)NC(N1CCC(CC1)C(NCc1csc(c2ccccc2)n1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.7866 |
| logD: | 3.7866 |
| logSw: | -3.9369 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 67.894 |
| InChI Key: | XDNJMUNGBKQXMT-UHFFFAOYSA-N |