4-[6-(2-methoxyphenoxy)pyrimidin-4-yl]-N-(2-methylphenyl)benzamide
Chemical Structure Depiction of
4-[6-(2-methoxyphenoxy)pyrimidin-4-yl]-N-(2-methylphenyl)benzamide
4-[6-(2-methoxyphenoxy)pyrimidin-4-yl]-N-(2-methylphenyl)benzamide
Compound characteristics
| Compound ID: | L533-0177 |
| Compound Name: | 4-[6-(2-methoxyphenoxy)pyrimidin-4-yl]-N-(2-methylphenyl)benzamide |
| Molecular Weight: | 411.46 |
| Molecular Formula: | C25 H21 N3 O3 |
| Smiles: | Cc1ccccc1NC(c1ccc(cc1)c1cc(ncn1)Oc1ccccc1OC)=O |
| Stereo: | ACHIRAL |
| logP: | 4.8455 |
| logD: | 4.8454 |
| logSw: | -4.6558 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.535 |
| InChI Key: | PRDXWHJNMURTRV-UHFFFAOYSA-N |