N-[(2H-1,3-benzodioxol-5-yl)methyl]-3-(6-phenoxypyrimidin-4-yl)benzamide
Chemical Structure Depiction of
N-[(2H-1,3-benzodioxol-5-yl)methyl]-3-(6-phenoxypyrimidin-4-yl)benzamide
N-[(2H-1,3-benzodioxol-5-yl)methyl]-3-(6-phenoxypyrimidin-4-yl)benzamide
Compound characteristics
| Compound ID: | L534-0779 |
| Compound Name: | N-[(2H-1,3-benzodioxol-5-yl)methyl]-3-(6-phenoxypyrimidin-4-yl)benzamide |
| Molecular Weight: | 425.44 |
| Molecular Formula: | C25 H19 N3 O4 |
| Smiles: | C(c1ccc2c(c1)OCO2)NC(c1cccc(c1)c1cc(ncn1)Oc1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.2457 |
| logD: | 4.2457 |
| logSw: | -4.5425 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 67.954 |
| InChI Key: | USXWREBKOYICLC-UHFFFAOYSA-N |