N-(3-chloro-4-methoxyphenyl)-5-[(4-methylphenyl)sulfamoyl]-1H-pyrazole-4-carboxamide
Chemical Structure Depiction of
N-(3-chloro-4-methoxyphenyl)-5-[(4-methylphenyl)sulfamoyl]-1H-pyrazole-4-carboxamide
N-(3-chloro-4-methoxyphenyl)-5-[(4-methylphenyl)sulfamoyl]-1H-pyrazole-4-carboxamide
Compound characteristics
| Compound ID: | L540-6237 |
| Compound Name: | N-(3-chloro-4-methoxyphenyl)-5-[(4-methylphenyl)sulfamoyl]-1H-pyrazole-4-carboxamide |
| Molecular Weight: | 420.87 |
| Molecular Formula: | C18 H17 Cl N4 O4 S |
| Smiles: | Cc1ccc(cc1)NS(c1c(cn[nH]1)C(Nc1ccc(c(c1)[Cl])OC)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.5828 |
| logD: | 3.4232 |
| logSw: | -3.9669 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 95.846 |
| InChI Key: | JJWHGYTVONWOTI-UHFFFAOYSA-N |