5-[(3,5-dimethylphenyl)sulfamoyl]-N-(3-fluoro-4-methylphenyl)-1H-pyrazole-4-carboxamide
Chemical Structure Depiction of
5-[(3,5-dimethylphenyl)sulfamoyl]-N-(3-fluoro-4-methylphenyl)-1H-pyrazole-4-carboxamide
5-[(3,5-dimethylphenyl)sulfamoyl]-N-(3-fluoro-4-methylphenyl)-1H-pyrazole-4-carboxamide
Compound characteristics
| Compound ID: | L540-6360 |
| Compound Name: | 5-[(3,5-dimethylphenyl)sulfamoyl]-N-(3-fluoro-4-methylphenyl)-1H-pyrazole-4-carboxamide |
| Molecular Weight: | 402.45 |
| Molecular Formula: | C19 H19 F N4 O3 S |
| Smiles: | Cc1cc(C)cc(c1)NS(c1c(cn[nH]1)C(Nc1ccc(C)c(c1)F)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.8191 |
| logD: | 3.6595 |
| logSw: | -3.8415 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 88.216 |
| InChI Key: | CQWVWPFGQIVPIF-UHFFFAOYSA-N |