N-[(3-chloro-4-fluorophenyl)methyl]-5-[(4-chlorophenyl)sulfamoyl]-1H-pyrazole-4-carboxamide
Chemical Structure Depiction of
N-[(3-chloro-4-fluorophenyl)methyl]-5-[(4-chlorophenyl)sulfamoyl]-1H-pyrazole-4-carboxamide
N-[(3-chloro-4-fluorophenyl)methyl]-5-[(4-chlorophenyl)sulfamoyl]-1H-pyrazole-4-carboxamide
Compound characteristics
| Compound ID: | L540-8092 |
| Compound Name: | N-[(3-chloro-4-fluorophenyl)methyl]-5-[(4-chlorophenyl)sulfamoyl]-1H-pyrazole-4-carboxamide |
| Molecular Weight: | 443.28 |
| Molecular Formula: | C17 H13 Cl2 F N4 O3 S |
| Smiles: | C(c1ccc(c(c1)[Cl])F)NC(c1cn[nH]c1S(Nc1ccc(cc1)[Cl])(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.8221 |
| logD: | 3.5873 |
| logSw: | -4.41 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 89.538 |
| InChI Key: | ZDVPBGOLEBBPHU-UHFFFAOYSA-N |