N-[(2,4-dimethoxyphenyl)methyl]-1-[(5-methoxy-1-methyl-1H-indol-3-yl)methyl]piperidine-4-carboxamide
Chemical Structure Depiction of
N-[(2,4-dimethoxyphenyl)methyl]-1-[(5-methoxy-1-methyl-1H-indol-3-yl)methyl]piperidine-4-carboxamide
N-[(2,4-dimethoxyphenyl)methyl]-1-[(5-methoxy-1-methyl-1H-indol-3-yl)methyl]piperidine-4-carboxamide
Compound characteristics
| Compound ID: | L589-2001 |
| Compound Name: | N-[(2,4-dimethoxyphenyl)methyl]-1-[(5-methoxy-1-methyl-1H-indol-3-yl)methyl]piperidine-4-carboxamide |
| Molecular Weight: | 451.57 |
| Molecular Formula: | C26 H33 N3 O4 |
| Smiles: | Cn1cc(CN2CCC(CC2)C(NCc2ccc(cc2OC)OC)=O)c2cc(ccc12)OC |
| Stereo: | ACHIRAL |
| logP: | 3.2568 |
| logD: | -1.4698 |
| logSw: | -3.2353 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 53.662 |
| InChI Key: | ZCLNXMYKJBLYLS-UHFFFAOYSA-N |