1-[(1-ethyl-1H-indol-3-yl)methyl]-N-[(4-methoxyphenyl)methyl]piperidine-4-carboxamide
Chemical Structure Depiction of
1-[(1-ethyl-1H-indol-3-yl)methyl]-N-[(4-methoxyphenyl)methyl]piperidine-4-carboxamide
1-[(1-ethyl-1H-indol-3-yl)methyl]-N-[(4-methoxyphenyl)methyl]piperidine-4-carboxamide
Compound characteristics
| Compound ID: | L589-2854 |
| Compound Name: | 1-[(1-ethyl-1H-indol-3-yl)methyl]-N-[(4-methoxyphenyl)methyl]piperidine-4-carboxamide |
| Molecular Weight: | 405.54 |
| Molecular Formula: | C25 H31 N3 O2 |
| Smiles: | [H]c1c(CN2CCC(CC2)C(NCc2ccc(cc2)OC)=O)c2ccccc2n1CC |
| Stereo: | ACHIRAL |
| logP: | 3.2194 |
| logD: | -2.485 |
| logSw: | -3.0404 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 37.657 |
| InChI Key: | JOPUJAGYWUWDHM-UHFFFAOYSA-N |