3-[2-(azepan-1-yl)-2-oxoethyl]-1-methyl-6-(2-methylpiperidine-1-sulfonyl)quinazoline-2,4(1H,3H)-dione
Chemical Structure Depiction of
3-[2-(azepan-1-yl)-2-oxoethyl]-1-methyl-6-(2-methylpiperidine-1-sulfonyl)quinazoline-2,4(1H,3H)-dione
3-[2-(azepan-1-yl)-2-oxoethyl]-1-methyl-6-(2-methylpiperidine-1-sulfonyl)quinazoline-2,4(1H,3H)-dione
Compound characteristics
| Compound ID: | L596-0463 |
| Compound Name: | 3-[2-(azepan-1-yl)-2-oxoethyl]-1-methyl-6-(2-methylpiperidine-1-sulfonyl)quinazoline-2,4(1H,3H)-dione |
| Molecular Weight: | 476.59 |
| Molecular Formula: | C23 H32 N4 O5 S |
| Smiles: | CC1CCCCN1S(c1ccc2c(c1)C(N(CC(N1CCCCCC1)=O)C(N2C)=O)=O)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.1858 |
| logD: | 2.1858 |
| logSw: | -3.0405 |
| Hydrogen bond acceptors count: | 11 |
| Polar surface area: | 79.8 |
| InChI Key: | XYGSJDUFGARJEJ-KRWDZBQOSA-N |