2-methoxy-5-(2-methyl-1,3-thiazol-4-yl)-N-phenylbenzene-1-sulfonamide
Chemical Structure Depiction of
2-methoxy-5-(2-methyl-1,3-thiazol-4-yl)-N-phenylbenzene-1-sulfonamide
2-methoxy-5-(2-methyl-1,3-thiazol-4-yl)-N-phenylbenzene-1-sulfonamide
Compound characteristics
| Compound ID: | L598-1017 |
| Compound Name: | 2-methoxy-5-(2-methyl-1,3-thiazol-4-yl)-N-phenylbenzene-1-sulfonamide |
| Molecular Weight: | 360.45 |
| Molecular Formula: | C17 H16 N2 O3 S2 |
| Smiles: | Cc1nc(cs1)c1ccc(c(c1)S(Nc1ccccc1)(=O)=O)OC |
| Stereo: | ACHIRAL |
| logP: | 3.8551 |
| logD: | 3.8296 |
| logSw: | -4.0754 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 58.059 |
| InChI Key: | OVZVJJDRJWEPJF-UHFFFAOYSA-N |