N-[(3-chlorophenyl)methyl]-5-(5-phenyl-1,2,4-oxadiazol-3-yl)thiophene-2-carboxamide
Chemical Structure Depiction of
N-[(3-chlorophenyl)methyl]-5-(5-phenyl-1,2,4-oxadiazol-3-yl)thiophene-2-carboxamide
N-[(3-chlorophenyl)methyl]-5-(5-phenyl-1,2,4-oxadiazol-3-yl)thiophene-2-carboxamide
Compound characteristics
| Compound ID: | L646-0662F |
| Compound Name: | N-[(3-chlorophenyl)methyl]-5-(5-phenyl-1,2,4-oxadiazol-3-yl)thiophene-2-carboxamide |
| Molecular Weight: | 395.87 |
| Molecular Formula: | C20 H14 Cl N3 O2 S |
| Smiles: | C(c1cccc(c1)[Cl])NC(c1ccc(c2nc(c3ccccc3)on2)s1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.5102 |
| logD: | 5.5102 |
| logSw: | -5.9592 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 57.076 |
| InChI Key: | JANGAFALQVLKLU-UHFFFAOYSA-N |