N-cyclopentyl-2-(2,4-dimethylanilino)-1,3-thiazole-4-carboxamide
Chemical Structure Depiction of
N-cyclopentyl-2-(2,4-dimethylanilino)-1,3-thiazole-4-carboxamide
N-cyclopentyl-2-(2,4-dimethylanilino)-1,3-thiazole-4-carboxamide
Compound characteristics
| Compound ID: | L650-1001 |
| Compound Name: | N-cyclopentyl-2-(2,4-dimethylanilino)-1,3-thiazole-4-carboxamide |
| Molecular Weight: | 315.44 |
| Molecular Formula: | C17 H21 N3 O S |
| Smiles: | Cc1ccc(c(C)c1)Nc1nc(cs1)C(NC1CCCC1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.8145 |
| logD: | 4.8145 |
| logSw: | -4.5488 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 43.004 |
| InChI Key: | TURYVUUVOULVEL-UHFFFAOYSA-N |