6-(3,5-dimethyl-1H-pyrazol-1-yl)-N-[(4-methylphenyl)methyl]pyrimidin-4-amine
Chemical Structure Depiction of
6-(3,5-dimethyl-1H-pyrazol-1-yl)-N-[(4-methylphenyl)methyl]pyrimidin-4-amine
6-(3,5-dimethyl-1H-pyrazol-1-yl)-N-[(4-methylphenyl)methyl]pyrimidin-4-amine
Compound characteristics
| Compound ID: | L656-0050 |
| Compound Name: | 6-(3,5-dimethyl-1H-pyrazol-1-yl)-N-[(4-methylphenyl)methyl]pyrimidin-4-amine |
| Molecular Weight: | 293.37 |
| Molecular Formula: | C17 H19 N5 |
| Smiles: | Cc1ccc(CNc2cc(ncn2)n2c(C)cc(C)n2)cc1 |
| Stereo: | ACHIRAL |
| logP: | 3.3035 |
| logD: | 3.1839 |
| logSw: | -3.1444 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.185 |
| InChI Key: | ROPJWWSDDLUFIL-UHFFFAOYSA-N |