N-(3-fluorophenyl)-3-{[2-(4-fluorophenyl)pyrimidin-4-yl]oxy}benzamide
Chemical Structure Depiction of
N-(3-fluorophenyl)-3-{[2-(4-fluorophenyl)pyrimidin-4-yl]oxy}benzamide
N-(3-fluorophenyl)-3-{[2-(4-fluorophenyl)pyrimidin-4-yl]oxy}benzamide
Compound characteristics
| Compound ID: | L661-0589 |
| Compound Name: | N-(3-fluorophenyl)-3-{[2-(4-fluorophenyl)pyrimidin-4-yl]oxy}benzamide |
| Molecular Weight: | 403.39 |
| Molecular Formula: | C23 H15 F2 N3 O2 |
| Smiles: | c1cc(cc(c1)Oc1ccnc(c2ccc(cc2)F)n1)C(Nc1cccc(c1)F)=O |
| Stereo: | ACHIRAL |
| logP: | 4.7822 |
| logD: | 4.7768 |
| logSw: | -4.927 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 48.709 |
| InChI Key: | GUPDYZXFUYHTLP-UHFFFAOYSA-N |