9-(4-chlorobenzene-1-sulfonyl)-N-[(3-methoxyphenyl)methyl]-1,4,9-triazaspiro[5.5]undec-4-en-5-amine--hydrogen chloride (1/1)
Chemical Structure Depiction of
9-(4-chlorobenzene-1-sulfonyl)-N-[(3-methoxyphenyl)methyl]-1,4,9-triazaspiro[5.5]undec-4-en-5-amine--hydrogen chloride (1/1)
9-(4-chlorobenzene-1-sulfonyl)-N-[(3-methoxyphenyl)methyl]-1,4,9-triazaspiro[5.5]undec-4-en-5-amine--hydrogen chloride (1/1)
Compound characteristics
| Compound ID: | L676-0501 |
| Compound Name: | 9-(4-chlorobenzene-1-sulfonyl)-N-[(3-methoxyphenyl)methyl]-1,4,9-triazaspiro[5.5]undec-4-en-5-amine--hydrogen chloride (1/1) |
| Molecular Weight: | 499.46 |
| Molecular Formula: | C22 H27 Cl N4 O3 S |
| Salt: | HCl |
| Smiles: | COc1cccc(CNC2C3(CCN(CC3)S(c3ccc(cc3)[Cl])(=O)=O)NCCN=2)c1 |
| Stereo: | ACHIRAL |
| logP: | 3.2782 |
| logD: | -0.4961 |
| logSw: | -3.7761 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 71.91 |
| InChI Key: | ZHBXFJUTPDBMAO-UHFFFAOYSA-N |