N-[(4-methoxyphenyl)methyl]-3-methyl-1-oxo-2-{[4-(trifluoromethyl)phenyl]methyl}-1,2,3,4-tetrahydroisoquinoline-3-carboxamide
Chemical Structure Depiction of
N-[(4-methoxyphenyl)methyl]-3-methyl-1-oxo-2-{[4-(trifluoromethyl)phenyl]methyl}-1,2,3,4-tetrahydroisoquinoline-3-carboxamide
N-[(4-methoxyphenyl)methyl]-3-methyl-1-oxo-2-{[4-(trifluoromethyl)phenyl]methyl}-1,2,3,4-tetrahydroisoquinoline-3-carboxamide
Compound characteristics
| Compound ID: | L678-0135 |
| Compound Name: | N-[(4-methoxyphenyl)methyl]-3-methyl-1-oxo-2-{[4-(trifluoromethyl)phenyl]methyl}-1,2,3,4-tetrahydroisoquinoline-3-carboxamide |
| Molecular Weight: | 482.5 |
| Molecular Formula: | C27 H25 F3 N2 O3 |
| Smiles: | CC1(Cc2ccccc2C(N1Cc1ccc(cc1)C(F)(F)F)=O)C(NCc1ccc(cc1)OC)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.4578 |
| logD: | 5.4578 |
| logSw: | -5.4062 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.89 |
| InChI Key: | ZMJZHCRLRMKMBV-SANMLTNESA-N |