N-cyclopentyl-1-{2-[(2,5-dimethoxyphenyl)carbamamido]ethyl}-1H-benzotriazole-5-carboxamide
Chemical Structure Depiction of
N-cyclopentyl-1-{2-[(2,5-dimethoxyphenyl)carbamamido]ethyl}-1H-benzotriazole-5-carboxamide
N-cyclopentyl-1-{2-[(2,5-dimethoxyphenyl)carbamamido]ethyl}-1H-benzotriazole-5-carboxamide
Compound characteristics
| Compound ID: | L693-0516 |
| Compound Name: | N-cyclopentyl-1-{2-[(2,5-dimethoxyphenyl)carbamamido]ethyl}-1H-benzotriazole-5-carboxamide |
| Molecular Weight: | 452.51 |
| Molecular Formula: | C23 H28 N6 O4 |
| Smiles: | COc1ccc(c(c1)NC(NCCn1c2ccc(cc2nn1)C(NC1CCCC1)=O)=O)OC |
| Stereo: | ACHIRAL |
| logP: | 2.3899 |
| logD: | 2.3898 |
| logSw: | -3.049 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 98.362 |
| InChI Key: | AEXUSZKFNSBOPF-UHFFFAOYSA-N |