N-(4-ethylphenyl)-1-methyl-2,4-dioxo-3-[3-oxo-3-(pyrrolidin-1-yl)propyl]-1,2,3,4-tetrahydroquinazoline-6-sulfonamide
Chemical Structure Depiction of
N-(4-ethylphenyl)-1-methyl-2,4-dioxo-3-[3-oxo-3-(pyrrolidin-1-yl)propyl]-1,2,3,4-tetrahydroquinazoline-6-sulfonamide
N-(4-ethylphenyl)-1-methyl-2,4-dioxo-3-[3-oxo-3-(pyrrolidin-1-yl)propyl]-1,2,3,4-tetrahydroquinazoline-6-sulfonamide
Compound characteristics
| Compound ID: | L695-0054 |
| Compound Name: | N-(4-ethylphenyl)-1-methyl-2,4-dioxo-3-[3-oxo-3-(pyrrolidin-1-yl)propyl]-1,2,3,4-tetrahydroquinazoline-6-sulfonamide |
| Molecular Weight: | 484.57 |
| Molecular Formula: | C24 H28 N4 O5 S |
| Smiles: | CCc1ccc(cc1)NS(c1ccc2c(c1)C(N(CCC(N1CCCC1)=O)C(N2C)=O)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.9822 |
| logD: | 2.9787 |
| logSw: | -3.7026 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 88.69 |
| InChI Key: | PJAMNIBZZYSKIW-UHFFFAOYSA-N |