3-(5-{5-[(4-chlorophenyl)methyl]-1,2,4-oxadiazol-3-yl}-1H-benzotriazol-1-yl)-1-(morpholin-4-yl)propan-1-one
Chemical Structure Depiction of
3-(5-{5-[(4-chlorophenyl)methyl]-1,2,4-oxadiazol-3-yl}-1H-benzotriazol-1-yl)-1-(morpholin-4-yl)propan-1-one
3-(5-{5-[(4-chlorophenyl)methyl]-1,2,4-oxadiazol-3-yl}-1H-benzotriazol-1-yl)-1-(morpholin-4-yl)propan-1-one
Compound characteristics
| Compound ID: | L701-0603 |
| Compound Name: | 3-(5-{5-[(4-chlorophenyl)methyl]-1,2,4-oxadiazol-3-yl}-1H-benzotriazol-1-yl)-1-(morpholin-4-yl)propan-1-one |
| Molecular Weight: | 452.9 |
| Molecular Formula: | C22 H21 Cl N6 O3 |
| Smiles: | C(Cn1c2ccc(cc2nn1)c1nc(Cc2ccc(cc2)[Cl])on1)C(N1CCOCC1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.9262 |
| logD: | 2.9262 |
| logSw: | -3.5703 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 81.015 |
| InChI Key: | CNESWKBGDHISMA-UHFFFAOYSA-N |