1-{4-[5-(3-methoxyphenyl)-1,2,4-oxadiazol-3-yl]piperidin-1-yl}-2-(4-methylphenoxy)ethan-1-one
Chemical Structure Depiction of
1-{4-[5-(3-methoxyphenyl)-1,2,4-oxadiazol-3-yl]piperidin-1-yl}-2-(4-methylphenoxy)ethan-1-one
1-{4-[5-(3-methoxyphenyl)-1,2,4-oxadiazol-3-yl]piperidin-1-yl}-2-(4-methylphenoxy)ethan-1-one
Compound characteristics
| Compound ID: | L703-5619 |
| Compound Name: | 1-{4-[5-(3-methoxyphenyl)-1,2,4-oxadiazol-3-yl]piperidin-1-yl}-2-(4-methylphenoxy)ethan-1-one |
| Molecular Weight: | 407.47 |
| Molecular Formula: | C23 H25 N3 O4 |
| Smiles: | Cc1ccc(cc1)OCC(N1CCC(CC1)c1nc(c2cccc(c2)OC)on1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.8414 |
| logD: | 3.8414 |
| logSw: | -3.9172 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 62.808 |
| InChI Key: | CWMDPAPRADTMLZ-UHFFFAOYSA-N |