1-[4-(4-chlorophenyl)piperazin-1-yl]-2-(6-phenylimidazo[2,1-b][1,3]thiazol-3-yl)ethan-1-one
Chemical Structure Depiction of
1-[4-(4-chlorophenyl)piperazin-1-yl]-2-(6-phenylimidazo[2,1-b][1,3]thiazol-3-yl)ethan-1-one
1-[4-(4-chlorophenyl)piperazin-1-yl]-2-(6-phenylimidazo[2,1-b][1,3]thiazol-3-yl)ethan-1-one
Compound characteristics
| Compound ID: | L708-0038 |
| Compound Name: | 1-[4-(4-chlorophenyl)piperazin-1-yl]-2-(6-phenylimidazo[2,1-b][1,3]thiazol-3-yl)ethan-1-one |
| Molecular Weight: | 436.96 |
| Molecular Formula: | C23 H21 Cl N4 O S |
| Smiles: | C(C(N1CCN(CC1)c1ccc(cc1)[Cl])=O)c1csc2nc(cn12)c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 4.8568 |
| logD: | 4.8565 |
| logSw: | -5.0802 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 28.5575 |
| InChI Key: | MSNWOXPVVOEXLD-UHFFFAOYSA-N |