N-[(4-methoxyphenyl)methyl]-2-(6-phenylimidazo[2,1-b][1,3]thiazol-3-yl)acetamide
Chemical Structure Depiction of
N-[(4-methoxyphenyl)methyl]-2-(6-phenylimidazo[2,1-b][1,3]thiazol-3-yl)acetamide
N-[(4-methoxyphenyl)methyl]-2-(6-phenylimidazo[2,1-b][1,3]thiazol-3-yl)acetamide
Compound characteristics
| Compound ID: | L708-0065 |
| Compound Name: | N-[(4-methoxyphenyl)methyl]-2-(6-phenylimidazo[2,1-b][1,3]thiazol-3-yl)acetamide |
| Molecular Weight: | 377.46 |
| Molecular Formula: | C21 H19 N3 O2 S |
| Smiles: | COc1ccc(CNC(Cc2csc3nc(cn23)c2ccccc2)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 3.8415 |
| logD: | 3.8412 |
| logSw: | -3.9665 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.92 |
| InChI Key: | CJCGIYUJWVDEMP-UHFFFAOYSA-N |