N-(4-acetylphenyl)-2-[6-(4-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetamide
Chemical Structure Depiction of
N-(4-acetylphenyl)-2-[6-(4-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetamide
N-(4-acetylphenyl)-2-[6-(4-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetamide
Compound characteristics
| Compound ID: | L708-1184 |
| Compound Name: | N-(4-acetylphenyl)-2-[6-(4-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetamide |
| Molecular Weight: | 405.47 |
| Molecular Formula: | C22 H19 N3 O3 S |
| Smiles: | CC(c1ccc(cc1)NC(Cc1csc2nc(cn12)c1ccc(cc1)OC)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.8263 |
| logD: | 3.8257 |
| logSw: | -3.9788 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 53.425 |
| InChI Key: | VDDOOGMZJNOQCC-UHFFFAOYSA-N |