2-[6-(3-chlorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]-N-(4-fluorophenyl)acetamide
Chemical Structure Depiction of
2-[6-(3-chlorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]-N-(4-fluorophenyl)acetamide
2-[6-(3-chlorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]-N-(4-fluorophenyl)acetamide
Compound characteristics
| Compound ID: | L708-1631 |
| Compound Name: | 2-[6-(3-chlorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]-N-(4-fluorophenyl)acetamide |
| Molecular Weight: | 385.85 |
| Molecular Formula: | C19 H13 Cl F N3 O S |
| Smiles: | C(C(Nc1ccc(cc1)F)=O)c1csc2nc(cn12)c1cccc(c1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 4.87 |
| logD: | 4.8695 |
| logSw: | -4.9473 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 32.054 |
| InChI Key: | LPLWZZUVQYYTSG-UHFFFAOYSA-N |