6-(4-chlorobenzamido)-N-(4-phenylbutan-2-yl)-3,4-dihydro-2H-1-benzopyran-3-carboxamide
Chemical Structure Depiction of
6-(4-chlorobenzamido)-N-(4-phenylbutan-2-yl)-3,4-dihydro-2H-1-benzopyran-3-carboxamide
6-(4-chlorobenzamido)-N-(4-phenylbutan-2-yl)-3,4-dihydro-2H-1-benzopyran-3-carboxamide
Compound characteristics
| Compound ID: | L722-0718 |
| Compound Name: | 6-(4-chlorobenzamido)-N-(4-phenylbutan-2-yl)-3,4-dihydro-2H-1-benzopyran-3-carboxamide |
| Molecular Weight: | 462.98 |
| Molecular Formula: | C27 H27 Cl N2 O3 |
| Smiles: | CC(CCc1ccccc1)NC(C1Cc2cc(ccc2OC1)NC(c1ccc(cc1)[Cl])=O)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 5.4632 |
| logD: | 5.4618 |
| logSw: | -6.0644 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 55.554 |
| InChI Key: | KGSJADUYBVRLMH-UHFFFAOYSA-N |