6-(4-chlorobenzamido)-N-[(2-fluorophenyl)methyl]-3,4-dihydro-2H-1-benzopyran-3-carboxamide
Chemical Structure Depiction of
6-(4-chlorobenzamido)-N-[(2-fluorophenyl)methyl]-3,4-dihydro-2H-1-benzopyran-3-carboxamide
6-(4-chlorobenzamido)-N-[(2-fluorophenyl)methyl]-3,4-dihydro-2H-1-benzopyran-3-carboxamide
Compound characteristics
| Compound ID: | L722-0720 |
| Compound Name: | 6-(4-chlorobenzamido)-N-[(2-fluorophenyl)methyl]-3,4-dihydro-2H-1-benzopyran-3-carboxamide |
| Molecular Weight: | 438.88 |
| Molecular Formula: | C24 H20 Cl F N2 O3 |
| Smiles: | C1C(COc2ccc(cc12)NC(c1ccc(cc1)[Cl])=O)C(NCc1ccccc1F)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.6578 |
| logD: | 4.6564 |
| logSw: | -5.0672 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 56.113 |
| InChI Key: | JUJAIBYWLICOKM-GOSISDBHSA-N |