N-[(3-methoxyphenyl)methyl]-6-phenyl[1,2,4]triazolo[4,3-b]pyridazine-3-carboxamide
Chemical Structure Depiction of
N-[(3-methoxyphenyl)methyl]-6-phenyl[1,2,4]triazolo[4,3-b]pyridazine-3-carboxamide
N-[(3-methoxyphenyl)methyl]-6-phenyl[1,2,4]triazolo[4,3-b]pyridazine-3-carboxamide
Compound characteristics
| Compound ID: | L737-1243 |
| Compound Name: | N-[(3-methoxyphenyl)methyl]-6-phenyl[1,2,4]triazolo[4,3-b]pyridazine-3-carboxamide |
| Molecular Weight: | 359.39 |
| Molecular Formula: | C20 H17 N5 O2 |
| Smiles: | COc1cccc(CNC(c2nnc3ccc(c4ccccc4)nn23)=O)c1 |
| Stereo: | ACHIRAL |
| logP: | 2.7685 |
| logD: | 2.7685 |
| logSw: | -3.3155 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 64.354 |
| InChI Key: | SOSDYZMFRLIOHZ-UHFFFAOYSA-N |