1-(5-chloro-2-methoxyphenyl)-5-(pyridin-4-yl)-N-[2-(thiophen-2-yl)ethyl]-1H-1,2,3-triazole-4-carboxamide
Chemical Structure Depiction of
1-(5-chloro-2-methoxyphenyl)-5-(pyridin-4-yl)-N-[2-(thiophen-2-yl)ethyl]-1H-1,2,3-triazole-4-carboxamide
1-(5-chloro-2-methoxyphenyl)-5-(pyridin-4-yl)-N-[2-(thiophen-2-yl)ethyl]-1H-1,2,3-triazole-4-carboxamide
Compound characteristics
| Compound ID: | L741-2597 |
| Compound Name: | 1-(5-chloro-2-methoxyphenyl)-5-(pyridin-4-yl)-N-[2-(thiophen-2-yl)ethyl]-1H-1,2,3-triazole-4-carboxamide |
| Molecular Weight: | 439.92 |
| Molecular Formula: | C21 H18 Cl N5 O2 S |
| Smiles: | COc1ccc(cc1n1c(c2ccncc2)c(C(NCCc2cccs2)=O)nn1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 2.9397 |
| logD: | 2.9396 |
| logSw: | -3.6583 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 67.87 |
| InChI Key: | XSYCSTDAIBCBMT-UHFFFAOYSA-N |