1-(4-ethylphenyl)-5-(pyridin-4-yl)-N-[(pyridin-4-yl)methyl]-1H-1,2,3-triazole-4-carboxamide
Chemical Structure Depiction of
1-(4-ethylphenyl)-5-(pyridin-4-yl)-N-[(pyridin-4-yl)methyl]-1H-1,2,3-triazole-4-carboxamide
1-(4-ethylphenyl)-5-(pyridin-4-yl)-N-[(pyridin-4-yl)methyl]-1H-1,2,3-triazole-4-carboxamide
Compound characteristics
| Compound ID: | L741-3419 |
| Compound Name: | 1-(4-ethylphenyl)-5-(pyridin-4-yl)-N-[(pyridin-4-yl)methyl]-1H-1,2,3-triazole-4-carboxamide |
| Molecular Weight: | 384.44 |
| Molecular Formula: | C22 H20 N6 O |
| Smiles: | CCc1ccc(cc1)n1c(c2ccncc2)c(C(NCc2ccncc2)=O)nn1 |
| Stereo: | ACHIRAL |
| logP: | 2.2366 |
| logD: | 2.2332 |
| logSw: | -2.249 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 69.109 |
| InChI Key: | YINSHQIICPQPKJ-UHFFFAOYSA-N |