N-(4-acetylphenyl)-2-(1-methyl-1H-pyrrol-2-yl)-2-oxoacetamide
Chemical Structure Depiction of
N-(4-acetylphenyl)-2-(1-methyl-1H-pyrrol-2-yl)-2-oxoacetamide
N-(4-acetylphenyl)-2-(1-methyl-1H-pyrrol-2-yl)-2-oxoacetamide
Compound characteristics
| Compound ID: | L793-0398 |
| Compound Name: | N-(4-acetylphenyl)-2-(1-methyl-1H-pyrrol-2-yl)-2-oxoacetamide |
| Molecular Weight: | 270.29 |
| Molecular Formula: | C15 H14 N2 O3 |
| Smiles: | CC(c1ccc(cc1)NC(C(c1cccn1C)=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.304 |
| logD: | 2.2714 |
| logSw: | -2.8666 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 53.312 |
| InChI Key: | XVXYODFHQAQBNF-UHFFFAOYSA-N |