N-(2-ethoxyphenyl)-2-{1-[(4-methylphenyl)methyl]-1H-pyrrol-2-yl}-2-oxoacetamide
Chemical Structure Depiction of
N-(2-ethoxyphenyl)-2-{1-[(4-methylphenyl)methyl]-1H-pyrrol-2-yl}-2-oxoacetamide
N-(2-ethoxyphenyl)-2-{1-[(4-methylphenyl)methyl]-1H-pyrrol-2-yl}-2-oxoacetamide
Compound characteristics
| Compound ID: | L793-3695 |
| Compound Name: | N-(2-ethoxyphenyl)-2-{1-[(4-methylphenyl)methyl]-1H-pyrrol-2-yl}-2-oxoacetamide |
| Molecular Weight: | 362.43 |
| Molecular Formula: | C22 H22 N2 O3 |
| Smiles: | CCOc1ccccc1NC(C(c1cccn1Cc1ccc(C)cc1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.7218 |
| logD: | 4.7178 |
| logSw: | -4.3031 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.17 |
| InChI Key: | KOUZHNWXFDSITF-UHFFFAOYSA-N |