N-(2,4-dimethylphenyl)-2-{1-[(4-fluorophenyl)methyl]-1H-pyrrol-2-yl}-2-oxoacetamide
Chemical Structure Depiction of
N-(2,4-dimethylphenyl)-2-{1-[(4-fluorophenyl)methyl]-1H-pyrrol-2-yl}-2-oxoacetamide
N-(2,4-dimethylphenyl)-2-{1-[(4-fluorophenyl)methyl]-1H-pyrrol-2-yl}-2-oxoacetamide
Compound characteristics
| Compound ID: | L793-4413 |
| Compound Name: | N-(2,4-dimethylphenyl)-2-{1-[(4-fluorophenyl)methyl]-1H-pyrrol-2-yl}-2-oxoacetamide |
| Molecular Weight: | 350.39 |
| Molecular Formula: | C21 H19 F N2 O2 |
| Smiles: | Cc1ccc(c(C)c1)NC(C(c1cccn1Cc1ccc(cc1)F)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.6355 |
| logD: | 4.6352 |
| logSw: | -4.2949 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 37.96 |
| InChI Key: | LGRKCYKYMQSMDH-UHFFFAOYSA-N |