N-(3-acetylphenyl)-2-{1-[(4-fluorophenyl)methyl]-1H-pyrrol-2-yl}-2-oxoacetamide
Chemical Structure Depiction of
N-(3-acetylphenyl)-2-{1-[(4-fluorophenyl)methyl]-1H-pyrrol-2-yl}-2-oxoacetamide
N-(3-acetylphenyl)-2-{1-[(4-fluorophenyl)methyl]-1H-pyrrol-2-yl}-2-oxoacetamide
Compound characteristics
| Compound ID: | L793-4440 |
| Compound Name: | N-(3-acetylphenyl)-2-{1-[(4-fluorophenyl)methyl]-1H-pyrrol-2-yl}-2-oxoacetamide |
| Molecular Weight: | 364.37 |
| Molecular Formula: | C21 H17 F N2 O3 |
| Smiles: | CC(c1cccc(c1)NC(C(c1cccn1Cc1ccc(cc1)F)=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.6956 |
| logD: | 3.6878 |
| logSw: | -3.9163 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 52.484 |
| InChI Key: | ZLUNPRODXRSMRZ-UHFFFAOYSA-N |