ethyl 4-{[1-(3-oxo-3,4-dihydro-2H-1,4-benzothiazine-2-carbonyl)piperidine-4-carbonyl]amino}benzoate
Chemical Structure Depiction of
ethyl 4-{[1-(3-oxo-3,4-dihydro-2H-1,4-benzothiazine-2-carbonyl)piperidine-4-carbonyl]amino}benzoate
ethyl 4-{[1-(3-oxo-3,4-dihydro-2H-1,4-benzothiazine-2-carbonyl)piperidine-4-carbonyl]amino}benzoate
Compound characteristics
| Compound ID: | L794-0100 |
| Compound Name: | ethyl 4-{[1-(3-oxo-3,4-dihydro-2H-1,4-benzothiazine-2-carbonyl)piperidine-4-carbonyl]amino}benzoate |
| Molecular Weight: | 467.54 |
| Molecular Formula: | C24 H25 N3 O5 S |
| Smiles: | CCOC(c1ccc(cc1)NC(C1CCN(CC1)C(C1C(Nc2ccccc2S1)=O)=O)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.7577 |
| logD: | 2.7572 |
| logSw: | -3.1562 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 85.609 |
| InChI Key: | WZSUKPPKAJHIKY-HXUWFJFHSA-N |