5-(benzenesulfonyl)-N-cyclohexylthiophene-2-carboxamide
Chemical Structure Depiction of
5-(benzenesulfonyl)-N-cyclohexylthiophene-2-carboxamide
5-(benzenesulfonyl)-N-cyclohexylthiophene-2-carboxamide
Compound characteristics
| Compound ID: | L796-0040 |
| Compound Name: | 5-(benzenesulfonyl)-N-cyclohexylthiophene-2-carboxamide |
| Molecular Weight: | 349.47 |
| Molecular Formula: | C17 H19 N O3 S2 |
| Smiles: | C1CCC(CC1)NC(c1ccc(s1)S(c1ccccc1)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.94 |
| logD: | 3.94 |
| logSw: | -3.9962 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.896 |
| InChI Key: | OVTMWDOGEODCAU-UHFFFAOYSA-N |