[4-(4-chlorophenyl)piperazin-1-yl][2-(1,5-dimethyl-1H-pyrrol-2-yl)-1,3-thiazol-4-yl]methanone
Chemical Structure Depiction of
[4-(4-chlorophenyl)piperazin-1-yl][2-(1,5-dimethyl-1H-pyrrol-2-yl)-1,3-thiazol-4-yl]methanone
[4-(4-chlorophenyl)piperazin-1-yl][2-(1,5-dimethyl-1H-pyrrol-2-yl)-1,3-thiazol-4-yl]methanone
Compound characteristics
| Compound ID: | L802-0824 |
| Compound Name: | [4-(4-chlorophenyl)piperazin-1-yl][2-(1,5-dimethyl-1H-pyrrol-2-yl)-1,3-thiazol-4-yl]methanone |
| Molecular Weight: | 400.93 |
| Molecular Formula: | C20 H21 Cl N4 O S |
| Smiles: | Cc1ccc(c2nc(cs2)C(N2CCN(CC2)c2ccc(cc2)[Cl])=O)n1C |
| Stereo: | ACHIRAL |
| logP: | 4.2696 |
| logD: | 4.2696 |
| logSw: | -4.5199 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 32.138 |
| InChI Key: | SRJZCEOCTLHBLH-UHFFFAOYSA-N |