N-[(4-fluorophenyl)methyl]-1-(4-methylphenyl)-5-(pyridin-3-yl)-1H-1,2,3-triazole-4-carboxamide
Chemical Structure Depiction of
N-[(4-fluorophenyl)methyl]-1-(4-methylphenyl)-5-(pyridin-3-yl)-1H-1,2,3-triazole-4-carboxamide
N-[(4-fluorophenyl)methyl]-1-(4-methylphenyl)-5-(pyridin-3-yl)-1H-1,2,3-triazole-4-carboxamide
Compound characteristics
| Compound ID: | L806-0025 |
| Compound Name: | N-[(4-fluorophenyl)methyl]-1-(4-methylphenyl)-5-(pyridin-3-yl)-1H-1,2,3-triazole-4-carboxamide |
| Molecular Weight: | 387.42 |
| Molecular Formula: | C22 H18 F N5 O |
| Smiles: | Cc1ccc(cc1)n1c(c2cccnc2)c(C(NCc2ccc(cc2)F)=O)nn1 |
| Stereo: | ACHIRAL |
| logP: | 3.1453 |
| logD: | 3.1453 |
| logSw: | -2.992 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 59.771 |
| InChI Key: | PEHCFNYJXRWWSY-UHFFFAOYSA-N |