N-butyl-1-(3-chlorophenyl)-5-(pyridin-3-yl)-1H-1,2,3-triazole-4-carboxamide
Chemical Structure Depiction of
N-butyl-1-(3-chlorophenyl)-5-(pyridin-3-yl)-1H-1,2,3-triazole-4-carboxamide
N-butyl-1-(3-chlorophenyl)-5-(pyridin-3-yl)-1H-1,2,3-triazole-4-carboxamide
Compound characteristics
| Compound ID: | L806-3462 |
| Compound Name: | N-butyl-1-(3-chlorophenyl)-5-(pyridin-3-yl)-1H-1,2,3-triazole-4-carboxamide |
| Molecular Weight: | 355.83 |
| Molecular Formula: | C18 H18 Cl N5 O |
| Smiles: | CCCCNC(c1c(c2cccnc2)n(c2cccc(c2)[Cl])nn1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.1398 |
| logD: | 3.1398 |
| logSw: | -3.6003 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 59.883 |
| InChI Key: | AKBSSQWKOYYRQN-UHFFFAOYSA-N |