N-(3,4-difluorophenyl)-1-(4-fluoro-3-methylphenyl)-5-(pyridin-3-yl)-1H-1,2,3-triazole-4-carboxamide
Chemical Structure Depiction of
N-(3,4-difluorophenyl)-1-(4-fluoro-3-methylphenyl)-5-(pyridin-3-yl)-1H-1,2,3-triazole-4-carboxamide
N-(3,4-difluorophenyl)-1-(4-fluoro-3-methylphenyl)-5-(pyridin-3-yl)-1H-1,2,3-triazole-4-carboxamide
Compound characteristics
| Compound ID: | L806-4370 |
| Compound Name: | N-(3,4-difluorophenyl)-1-(4-fluoro-3-methylphenyl)-5-(pyridin-3-yl)-1H-1,2,3-triazole-4-carboxamide |
| Molecular Weight: | 409.37 |
| Molecular Formula: | C21 H14 F3 N5 O |
| Smiles: | Cc1cc(ccc1F)n1c(c2cccnc2)c(C(Nc2ccc(c(c2)F)F)=O)nn1 |
| Stereo: | ACHIRAL |
| logP: | 4.0561 |
| logD: | 4.0452 |
| logSw: | -3.8891 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 58.448 |
| InChI Key: | QDLMUDZSMJFENW-UHFFFAOYSA-N |