4-(4-chloro-2-fluorophenyl)-6-fluoro-1,1-dioxo-1,4-dihydro-1lambda~6~,4-benzothiazine-2-carbonitrile
Chemical Structure Depiction of
4-(4-chloro-2-fluorophenyl)-6-fluoro-1,1-dioxo-1,4-dihydro-1lambda~6~,4-benzothiazine-2-carbonitrile
4-(4-chloro-2-fluorophenyl)-6-fluoro-1,1-dioxo-1,4-dihydro-1lambda~6~,4-benzothiazine-2-carbonitrile
Compound characteristics
| Compound ID: | L807-0166 |
| Compound Name: | 4-(4-chloro-2-fluorophenyl)-6-fluoro-1,1-dioxo-1,4-dihydro-1lambda~6~,4-benzothiazine-2-carbonitrile |
| Molecular Weight: | 352.74 |
| Molecular Formula: | C15 H7 Cl F2 N2 O2 S |
| Smiles: | C1=C(C#N)S(c2ccc(cc2N1c1ccc(cc1F)[Cl])F)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.7707 |
| logD: | 2.7707 |
| logSw: | -3.4171 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 47.706 |
| InChI Key: | QGZSIALSUNNKFN-UHFFFAOYSA-N |