7-fluoro-4-(3-methoxyphenyl)-1,1-dioxo-1,4-dihydro-1lambda~6~,4-benzothiazine-2-carbonitrile
Chemical Structure Depiction of
7-fluoro-4-(3-methoxyphenyl)-1,1-dioxo-1,4-dihydro-1lambda~6~,4-benzothiazine-2-carbonitrile
7-fluoro-4-(3-methoxyphenyl)-1,1-dioxo-1,4-dihydro-1lambda~6~,4-benzothiazine-2-carbonitrile
Compound characteristics
| Compound ID: | L807-0214 |
| Compound Name: | 7-fluoro-4-(3-methoxyphenyl)-1,1-dioxo-1,4-dihydro-1lambda~6~,4-benzothiazine-2-carbonitrile |
| Molecular Weight: | 330.34 |
| Molecular Formula: | C16 H11 F N2 O3 S |
| Smiles: | COc1cccc(c1)N1C=C(C#N)S(c2cc(ccc12)F)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.3161 |
| logD: | 2.3161 |
| logSw: | -2.6724 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 55.55 |
| InChI Key: | BHKLDIGSHBHWQT-UHFFFAOYSA-N |