6-chloro-4-[4-(dimethylamino)phenyl]-2-(4-methylpiperidine-1-carbonyl)-1lambda~6~,4-benzothiazine-1,1(4H)-dione
Chemical Structure Depiction of
6-chloro-4-[4-(dimethylamino)phenyl]-2-(4-methylpiperidine-1-carbonyl)-1lambda~6~,4-benzothiazine-1,1(4H)-dione
6-chloro-4-[4-(dimethylamino)phenyl]-2-(4-methylpiperidine-1-carbonyl)-1lambda~6~,4-benzothiazine-1,1(4H)-dione
Compound characteristics
| Compound ID: | L810-1061 |
| Compound Name: | 6-chloro-4-[4-(dimethylamino)phenyl]-2-(4-methylpiperidine-1-carbonyl)-1lambda~6~,4-benzothiazine-1,1(4H)-dione |
| Molecular Weight: | 459.99 |
| Molecular Formula: | C23 H26 Cl N3 O3 S |
| Smiles: | CC1CCN(CC1)C(C1=CN(c2ccc(cc2)N(C)C)c2cc(ccc2S1(=O)=O)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 3.5805 |
| logD: | 3.5798 |
| logSw: | -3.9056 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 50.403 |
| InChI Key: | FENYUKWLYOJKEV-UHFFFAOYSA-N |