N-({5-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]thiophen-2-yl}methyl)acetamide
Chemical Structure Depiction of
N-({5-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]thiophen-2-yl}methyl)acetamide
N-({5-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]thiophen-2-yl}methyl)acetamide
Compound characteristics
| Compound ID: | L821-1263 |
| Compound Name: | N-({5-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]thiophen-2-yl}methyl)acetamide |
| Molecular Weight: | 333.79 |
| Molecular Formula: | C15 H12 Cl N3 O2 S |
| Smiles: | CC(NCc1ccc(c2nc(c3ccccc3[Cl])on2)s1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.2416 |
| logD: | 3.2416 |
| logSw: | -3.7066 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 57.247 |
| InChI Key: | UHRXYHTVDJRNOX-UHFFFAOYSA-N |